A0801912
4-Amino-4'-cyanobiphenyl , ≥95.0% , 4854-84-6
Synonym(s):
4′-Amino-[1,1′-biphenyl]-4-carbonitrile;4′-Aminobiphenyl-4-carbonitrile
| Pack Size | Price | Stock | Quantity |
| 1G | RMB687.20 | In Stock |
|
| 5G | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 182-186 °C(lit.) |
| Boiling point: | 320.68°C (rough estimate) |
| Density | 1.1579 (rough estimate) |
| refractive index | 1.5014 (estimate) |
| storage temp. | 2-8°C, protect from light |
| Water Solubility | Insoluble in water |
| solubility | Chloroform, Methanol (Sparingly) |
| form | powder to crystal |
| pka | 3.78±0.10(Predicted) |
| color | White to Amber |
| InChI | 1S/C13H10N2/c14-9-10-1-3-11(4-2-10)12-5-7-13(15)8-6-12/h1-8H,15H2 |
| InChIKey | CPJQKNUJNWPAPH-UHFFFAOYSA-N |
| SMILES | Nc1ccc(cc1)-c2ccc(cc2)C#N |
| CAS DataBase Reference | 4854-84-6(CAS DataBase Reference) |
Description and Uses
4-(4-Aminophenyl)benzonitrile is used as a reagent in the synthesis of pirinixic acid derivatives which serve as dual microsomal PGE2 synthase-1/5-lipoxygenase inhibitors. Also used as a reagent in the synthesis of novel diazepane derivatives as factor Xa inhibitors with potent anticoagulant and antithrombotic activity.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS09,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H319-H302-H312-H318-H332-H400 |
| Precautionary statements | P264-P270-P301+P312+P330-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P501-P273-P280-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,N |
| Risk Statements | 20/21/22-41-50 |
| Safety Statements | 26-36/39-60-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| RTECS | DV1763000 |
| HS Code | 2926907090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Acute 1 Eye Dam. 1 |







