PRODUCT Properties
| Melting point: | 76-79 °C (lit.) |
| Boiling point: | 320.3±15.0 °C(Predicted) |
| Density | 1.439±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| form | solid |
| Appearance | White to off-white Solid |
| InChI | 1S/C12H17BrO/c13-7-11(14)12-4-8-1-9(5-12)3-10(2-8)6-12/h8-10H,1-7H2/t8-,9+,10-,12- |
| InChIKey | KWCDIRFSULAMOC-GOCCLTDMSA-N |
| SMILES | BrCC(=O)C12C[C@H]3C[C@H](C[C@H](C3)C1)C2 |
| CAS DataBase Reference | 5122-82-7(CAS DataBase Reference) |
Description and Uses
1-Adamantyl bromomethyl ketone may be used in chemical synthesis studies.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36/37/39-27 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29142900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
