A0805212
2-Amino-6-methoxy-3-nitropyridine , ≥97.0%(HPLC) , 73896-36-3
CAS NO.:73896-36-3
Empirical Formula: C6H7N3O3
Molecular Weight: 169.14
MDL number: MFCD03206481
EINECS: 616-028-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB43.20 | In Stock |
|
| 25G | RMB129.60 | In Stock |
|
| 100G | RMB405.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 171-172°C |
| Boiling point: | 338.5±37.0 °C(Predicted) |
| Density | 1.400±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | solid |
| pka | 0.17±0.50(Predicted) |
| color | Yellow |
| InChI | 1S/C6H7N3O3/c1-12-5-3-2-4(9(10)11)6(7)8-5/h2-3H,1H3,(H2,7,8) |
| InChIKey | RDJILYVRVOTMTQ-UHFFFAOYSA-N |
| SMILES | COc1ccc(c(N)n1)[N+]([O-])=O |
| CAS DataBase Reference | 73896-36-3(CAS DataBase Reference) |
Description and Uses
2-Amino-6-methoxy-3-nitropyridine is used as an intermediate in the drug tetrapazole.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H315-H319-H334-H335 |
| Precautionary statements | P301+P312+P330-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-36/37/38-43 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Resp. Sens. 1 Skin Irrit. 2 STOT SE 3 |




