A0805412
3-Aminophenylboronic acid , ≥98%(including non -equivalent acid anhydride) , 30418-59-8
Synonym(s):
3-Aminobenzeneboronic acid
CAS NO.：30418-59-8
Empirical Formula: C6H8BNO2
Molecular Weight: 136.94
MDL number: MFCD00007755
EINECS: 250-189-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB36.80 | In Stock |
|
| 5G | RMB123.20 | In Stock |
|
| 25G | RMB477.60 | In Stock |
|
| 100G | RMB1488.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 225 °C |
| Boiling point: | 376.0±44.0 °C(Predicted) |
| Density | 1.23±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| form | powder or crystals |
| pka | pK1: 4.46;pK2: 8.81 (25°C) |
| color | Off-white to light brown |
| Water Solubility | Soluble in water (partly miscible). |
| InChI | InChI=1S/C6H8BNO2/c8-6-3-1-2-5(4-6)7(9)10/h1-4,9-10H,8H2 |
| InChIKey | JMZFEHDNIAQMNB-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC(N)=C1)(O)O |
| CAS DataBase Reference | 30418-59-8(CAS DataBase Reference) |
Description and Uses
3-Aminobenzeneboronic acid is a boronic acid with potential use for biochemical research,it ie also used for suzuki reaction.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36/37/39-37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29310095 |
