A0811212
15-Acetyl Deoxynivalenol , 98% , 88337-96-6
Synonym(s):
15-AcDON;15-ADON;3-d3-AcDON;15-Acetoxy-3α,7α-dihydroxy-12,13-epoxytrichothec-9-en-8-one;15-Acetylvomitoxin
CAS NO.：88337-96-6
Empirical Formula: C17H22O7
Molecular Weight: 338.35
MDL number: MFCD00083218
EINECS: 621-572-3
| Pack Size | Price | Stock | Quantity |
| 1MG | RMB799.20 | In Stock |
|
| 5MG | RMB2855.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 538.6±50.0 °C(Predicted) |
| Density | 1.42±0.1 g/cm3(Predicted) |
| Flash point: | 2 °C |
| storage temp. | 2-8°C |
| solubility | Chloroform: soluble; Ethanol: soluble |
| pka | 11.83±0.70(Predicted) |
| form | Solid |
| color | White to off-white |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChI | 1S/C17H22O7/c1-8-4-11-16(6-22-9(2)18,13(21)12(8)20)15(3)5-10(19)14(24-11)17(15)7-23-17/h4,10-11,13-14,19,21H,5-7H2,1-3H3/t10-,11-,13-,14-,15-,16-,17+/m1/s1 |
| InChIKey | IDGRYIRJIFKTAN-HTJQZXIKSA-N |
| SMILES | [H][C@]12O[C@]3([H])[C@H](O)C[C@@](C)([C@]34CO4)[C@@]1(COC(C)=O)[C@H](O)C(=O)C(C)=C2 |
| LogP | -0.400 (est) |
Description and Uses
A mycotoxin produced by the fungi Fusarium culmorum and Fusarium graminearum, inhibits protein synthesis.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H300-H311+H331 |
| Precautionary statements | P280-P301+P310+P330-P302+P352+P312-P304+P340+P311 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | T,Xn,F |
| Risk Statements | 23/24/25-36-20/21/22-11 |
| Safety Statements | 36/37-45-26-16 |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | YD0155000 |
| HazardClass | 6.1(a) |
| PackingGroup | I |
| HS Code | 29329990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 |
