A0812612
5-Amino-3-methyl-1-phenylpyrazole , ≥98.0%(HPLC) , 1131-18-6
CAS NO.:1131-18-6
Empirical Formula: C10H11N3
Molecular Weight: 173.21
MDL number: MFCD00020727
EINECS: 214-463-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB31.20 | In Stock |
|
| 25G | RMB35.20 | In Stock |
|
| 100G | RMB101.60 | In Stock |
|
| 500G | RMB800.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 114-117 °C (lit.) |
| Boiling point: | 333 °C |
| Density | 1.2894 (rough estimate) |
| vapor pressure | 0.006Pa at 25℃ |
| refractive index | 1.6250 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 3.88±0.10(Predicted) |
| form | Solid |
| color | Yellow to pale brown |
| Water Solubility | 6.051g/L at 25℃ |
| InChI | InChI=1S/C10H11N3/c1-8-7-10(11)13(12-8)9-5-3-2-4-6-9/h2-7H,11H2,1H3 |
| InChIKey | FMKMKBLHMONXJM-UHFFFAOYSA-N |
| SMILES | N1(C2=CC=CC=C2)C(N)=CC(C)=N1 |
| LogP | 1.76 |
| CAS DataBase Reference | 1131-18-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 1H-Pyrazol-5-amine, 3-methyl-1-phenyl-(1131-18-6) |
| EPA Substance Registry System | 1H-Pyrazol-5-amine, 3-methyl-1-phenyl- (1131-18-6) |
Description and Uses
5-Amino-3-methyl-1-phenylpyrazole may be used to synthesize:
- substituted pyrazoles
- pyrazolopyridine derivatives
- pyrazolo[3,4,-b]pyridines
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | UQ4990000 |
| Hazard Note | Harmful |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29331990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | mouse,LD50,oral,1300mg/kg (1300mg/kg),BEHAVIORAL: CHANGES IN MOTOR ACTIVITY (SPECIFIC ASSAY)BEHAVIORAL: "HALLUCINATIONS, DISTORTED PERCEPTIONS",Personal Communication from LONZA Ltd., CH-4002, Basel, SwitzerlandVol. 03FEB1981, |



