A0814512
3-acetyl-2-chloropyridine , 98% , 55676-21-6
CAS NO.：55676-21-6
Empirical Formula: C7H6ClNO
Molecular Weight: 155.58
MDL number: MFCD03840751
EINECS: 695-379-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB56.80 | In Stock |
|
| 5G | RMB175.20 | In Stock |
|
| 25g | RMB704.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 114°C/15mmHg(lit.) |
| Density | 1.233±0.06 g/cm3(Predicted) |
| refractive index | 1.5440-1.5480 |
| Flash point: | >110℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| pka | -1.65±0.10(Predicted) |
| color | Colorless to Brown |
| InChI | InChI=1S/C7H6ClNO/c1-5(10)6-3-2-4-9-7(6)8/h2-4H,1H3 |
| InChIKey | WIWIOUAFBHZLNQ-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=CN=C1Cl)C |
| CAS DataBase Reference | 55676-21-6 |
Description and Uses
3-Acetyl-2-chloropyridine is a reagent used in the synthesis of Volitinib, a highly potent and selective mesenchymal-epithelial transition factor (c-Met) inhibitor as an anti-cancer agent.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-36 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
