A0815412
5-Amino-2-methylbenzenesulfonamide , ≥98.0%(HPLC) , 6973-09-7
CAS NO.：6973-09-7
Empirical Formula: C7H10N2O2S
Molecular Weight: 186.23
MDL number: MFCD06681071
EINECS: 691-180-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB40.80 | In Stock |
|
| 25G | RMB92.80 | In Stock |
|
| 100g | RMB319.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 163-164℃ |
| Boiling point: | 421.5±55.0 °C(Predicted) |
| Density | 1.359±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 10.43±0.60(Predicted) |
| form | Solid |
| color | Pale Beige |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C7H10N2O2S/c1-5-2-3-6(8)4-7(5)12(9,10)11/h2-4H,8H2,1H3,(H2,9,10,11) |
| InChIKey | KTPBKMYOIFHJMI-UHFFFAOYSA-N |
| SMILES | C1(S(N)(=O)=O)=CC(N)=CC=C1C |
| CAS DataBase Reference | 6973-09-7(CAS DataBase Reference) |
Description and Uses
5-Amino-2-methylbenzenesulfonamide is an intermediate for the synthesis of Pazopanib (P210925), an oral angiogenesis inhibitor targeting VEGFR and PDGFR.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| HS Code | 2935.90.9500 |
