A0826812
2-Amino-5-methyl-1,3,4-thiadiazole , >97.0% , 108-33-8
CAS NO.:108-33-8
Empirical Formula: C3H5N3S
Molecular Weight: 115.16
MDL number: MFCD00003110
EINECS: 203-573-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB48.00 | In Stock |
|
| 25G | RMB192.00 | In Stock |
|
| 100g | RMB469.60 | In Stock |
|
| 500g | RMB1920.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 223-228 °C |
| Boiling point: | 261.2±23.0 °C(Predicted) |
| Density | 1.287 (estimate) |
| refractive index | 1.5800 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Sparingly), Methanol (Slightly) |
| form | solid |
| pka | 3.84±0.10(Predicted) |
| color | Off-White |
| InChI | InChI=1S/C3H5N3S/c1-2-5-6-3(4)7-2/h1H3,(H2,4,6) |
| InChIKey | HMPUHXCGUHDVBI-UHFFFAOYSA-N |
| SMILES | S1C(C)=NN=C1N |
| CAS DataBase Reference | 108-33-8(CAS DataBase Reference) |
Description and Uses
2-Amino-5-methyl-1,3,4-thiadiazole was used as a reagent in the synthesis of substituted 5H-benzo[i][1,3,4]thiadiazolo[3,2-a]quinazoline-6,7-diones which diplayed good cytotoxic activities. Also used in the design of new phenothiazine-thiadiazole hybrids for development of antitubercular agents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-37/39-26 |
| WGK Germany | 3 |
| RTECS | XI3500000 |
| Hazard Note | Irritant |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



