A0829412
Aminoguanidine Hydrochloride , >98.0%(T) , 1937-19-5
CAS NO.:1937-19-5
Empirical Formula: CH7ClN4
Molecular Weight: 110.546
MDL number: MFCD00039074
EINECS: 217-707-7
| Pack Size | Price | Stock | Quantity |
| 25G | RMB31.20 | In Stock |
|
| 100G | RMB86.40 | In Stock |
|
| 500G | RMB371.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 162-166 °C(lit.) |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Completely soluble in water |
| form | Crystals |
| color | White to off-white |
| Water Solubility | 506.7g/L at 20℃ |
| Merck | 13,440 |
| BRN | 3909606 |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChI | InChI=1S/CH6N4.ClH/c2-1(3)5-4;/h4H2,(H4,2,3,5);1H |
| InChIKey | UBDZFAGVPPMTIT-UHFFFAOYSA-N |
| SMILES | N(N)C(=N)N.[H]Cl |
| LogP | -3.55 at 20℃ |
| CAS DataBase Reference | 1937-19-5(CAS DataBase Reference) |
| EPA Substance Registry System | Hydrazinecarboximidamide, monohydrochloride (1937-19-5) |
Description and Uses
Aminoguanidine is equipotent to L-
antitussive
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H317-H411 |
| Precautionary statements | P261-P272-P273-P280-P302+P352-P333+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | ME8430000 |
| F | 10-21 |
| HS Code | 29280000 |






