A0830612
Acrolein Dimethyl Acetal , >97.0%(GC) , 6044-68-4
Synonym(s):
3,3-Dimethoxy-1-propene
CAS NO.:6044-68-4
Empirical Formula: C5H10O2
Molecular Weight: 102.13
MDL number: MFCD00008632
EINECS: 227-936-4
| Pack Size | Price | Stock | Quantity |
| 5g | RMB23.20 | In Stock |
|
| 25G | RMB47.20 | In Stock |
|
| 100g | RMB151.20 | In Stock |
|
| 250G | RMB351.20 | In Stock |
|
| 500g | RMB639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 89-90 °C(lit.) |
| Density | 0.862 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 27 °F |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Colorless to Almost colorless |
| BRN | 1700037 |
| InChI | InChI=1S/C5H10O2/c1-4-5(6-2)7-3/h4-5H,1H2,2-3H3 |
| InChIKey | OBWGMYALGNDUNM-UHFFFAOYSA-N |
| SMILES | C=CC(OC)OC |
| LogP | 0.653 (est) |
| CAS DataBase Reference | 6044-68-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Acrolein,dimethyl acetal(6044-68-4) |
Description and Uses
Acrolein dimethyl acetal was used in the facile one step synthesis of 4-hydroxy-2E-nonenal and its dimethyl acetal via a cross-metathesis reaction with octen-3-ol.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Danger |
| Hazard statements | H225 |
| Precautionary statements | P210 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | F |
| Risk Statements | 11 |
| Safety Statements | 16-23-24/25-29-33 |
| RIDADR | UN 3384 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | UC8500000 |
| HazardClass | 3.1 |
| PackingGroup | II |
| HS Code | 2911000000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 2 |






