A0833812
5-Acetylthiophene-2-carboxylic Acid , 97% , 4066-41-5
CAS NO.:4066-41-5
Empirical Formula: C7H6O3S
Molecular Weight: 170.18
MDL number: MFCD00055512
EINECS: 609-857-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB62.40 | In Stock |
|
| 5G | RMB182.16 | In Stock |
|
| 10g | RMB449.60 | In Stock |
|
| 25G | RMB608.00 | In Stock |
|
| 100G | RMB1712.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 210-212°C |
| Boiling point: | 385.2±27.0 °C(Predicted) |
| Density | 1.383 |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 2.95±0.10(Predicted) |
| color | White to Yellow |
| BRN | 128897 |
| InChI | InChI=1S/C7H6O3S/c1-4(8)5-2-3-6(11-5)7(9)10/h2-3H,1H3,(H,9,10) |
| InChIKey | LIKIMWYKJUFVJP-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)SC(C(C)=O)=CC=1 |
| CAS DataBase Reference | 4066-41-5(CAS DataBase Reference) |
Description and Uses
5-Acetylthiophene-2-carboxylic acid is a light yellow crystal with good thermal and chemical stability. It can be dissolved in various organic solvents, such as ethanol, ether, and chloroform, making it easy to handle and process in chemical reactions. It can be used as a raw material to synthesize compounds such as 5-Ethylthiophene-2-carboxylic acid.
5-Acetylthiophene-2-carboxylic acid is a intermediate used in the preparation of various 2,5-disubstituted thiophenes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36/37/39-36 |
| Hazard Note | Irritant |
| HS Code | 2934999090 |





