A0836912
                    2-(4-Aminophenyl)ethanol , >98.0%(GC) , 104-10-9
                            Synonym(s):
2-(4-Aminophenyl)ethanol
                            
                        
                CAS NO.:104-10-9
Empirical Formula: C8H11NO
Molecular Weight: 137.18
MDL number: MFCD00007922
EINECS: 203-174-8
| Pack Size | Price | Stock | Quantity | 
| 5G | RMB58.40 | In Stock | 
                                                 | 
                                        
| 25G | RMB228.80 | In Stock | 
                                                 | 
                                        
| 100G | RMB781.60 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 107-110 °C(lit.) | 
                                    
| Boiling point: | 255 °C | 
                                    
| Density | 1.0630 (rough estimate) | 
                                    
| refractive index | 1.5470 (estimate) | 
                                    
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature | 
                                    
| solubility | Soluble in methanol. | 
                                    
| form | Crystals | 
                                    
| pka | 15.05±0.10(Predicted) | 
                                    
| color | Light brown to brown | 
                                    
| BRN | 907205 | 
                                    
| InChI | InChI=1S/C8H11NO/c9-8-3-1-7(2-4-8)5-6-10/h1-4,10H,5-6,9H2 | 
                                    
| InChIKey | QXHDYMUPPXAMPQ-UHFFFAOYSA-N | 
                                    
| SMILES | C1(CCO)=CC=C(N)C=C1 | 
                                    
| CAS DataBase Reference | 104-10-9(CAS DataBase Reference) | 
                                    
| EPA Substance Registry System | p-Aminophenylethanol (104-10-9) | 
                                    
Description and Uses
                                            4-Aminophenethyl alcohol has been used:
- as nonsymmetric monomer in the preparation of ordered [head-to-head (H-H) or tail-to-tail (T-T)] poly(amide-ester)
 - in the synthesis of 4-aminostyrene
 - in functionalization of graphene nanoplatelets
 
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H315-H319-H335 | 
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | 
| Hazard Codes | Xi | 
| Risk Statements | 36/37/38 | 
| Safety Statements | 26-36-24/25 | 
| WGK Germany | 3 | 
| F | 10-23 | 
| TSCA | T | 
| HazardClass | IRRITANT | 
| HS Code | 29221990 | 




