A0836912
2-(4-Aminophenyl)ethanol , >98.0%(GC) , 104-10-9
Synonym(s):
2-(4-Aminophenyl)ethanol
CAS NO.:104-10-9
Empirical Formula: C8H11NO
Molecular Weight: 137.18
MDL number: MFCD00007922
EINECS: 203-174-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB58.40 | In Stock |
|
| 25G | RMB228.80 | In Stock |
|
| 100G | RMB781.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 107-110 °C(lit.) |
| Boiling point: | 255 °C |
| Density | 1.0630 (rough estimate) |
| refractive index | 1.5470 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Soluble in methanol. |
| form | Crystals |
| pka | 15.05±0.10(Predicted) |
| color | Light brown to brown |
| BRN | 907205 |
| InChI | InChI=1S/C8H11NO/c9-8-3-1-7(2-4-8)5-6-10/h1-4,10H,5-6,9H2 |
| InChIKey | QXHDYMUPPXAMPQ-UHFFFAOYSA-N |
| SMILES | C1(CCO)=CC=C(N)C=C1 |
| CAS DataBase Reference | 104-10-9(CAS DataBase Reference) |
| EPA Substance Registry System | p-Aminophenylethanol (104-10-9) |
Description and Uses
4-Aminophenethyl alcohol has been used:
- as nonsymmetric monomer in the preparation of ordered [head-to-head (H-H) or tail-to-tail (T-T)] poly(amide-ester)
- in the synthesis of 4-aminostyrene
- in functionalization of graphene nanoplatelets
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| F | 10-23 |
| TSCA | T |
| HazardClass | IRRITANT |
| HS Code | 29221990 |




