A0837312
2-(2-Aminophenyl)ethanol , >95.0%(GC) , 5339-85-5
CAS NO.:5339-85-5
Empirical Formula: C8H11NO
Molecular Weight: 137.18
MDL number: MFCD00007754
EINECS: 226-275-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5G | RMB43.20 | In Stock |
|
| 25G | RMB118.40 | In Stock |
|
| 100G | RMB479.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 140-145 °C |
| Boiling point: | 147-148 °C/3.5 mmHg (lit.) |
| Density | 1.045 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 14.81±0.10(Predicted) |
| form | clear liquid |
| color | Light yellow to Yellow to Orange |
| InChI | InChI=1S/C8H11NO/c9-8-4-2-1-3-7(8)5-6-10/h1-4,10H,5-6,9H2 |
| InChIKey | ILDXSRFKXABMHH-UHFFFAOYSA-N |
| SMILES | C1(CCO)=CC=CC=C1N |
| CAS DataBase Reference | 5339-85-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzeneethanol, 2-amino-(5339-85-5) |
Description and Uses
2-Aminophenethyl alcohol was used in the synthesis of:
- indole derivatives
- N-(cyanothioformyl)indoline
- dihydro-3,1-benzoxazepine
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 2922190090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



