A0840212
3-Amino-2-naphthoic Acid , 97% , 5959-52-4
CAS NO.：5959-52-4
Empirical Formula: C11H9NO2
Molecular Weight: 187.19
MDL number: MFCD00004115
EINECS: 227-726-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB92.00 | In Stock |
|
| 5G | RMB368.80 | In Stock |
|
| 25g | RMB1495.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 212-215 °C (dec.) (lit.) |
| Boiling point: | 321.94°C (rough estimate) |
| Density | 1.1963 (rough estimate) |
| refractive index | 1.4900 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Powder |
| pka | 2.20±0.30(Predicted) |
| color | Yellow-green to green |
| Water Solubility | Soluble in alcohol and ether. Insoluble in water. |
| Merck | 14,452 |
| BRN | 744099 |
| InChI | InChI=1S/C11H9NO2/c12-10-6-8-4-2-1-3-7(8)5-9(10)11(13)14/h1-6H,12H2,(H,13,14) |
| InChIKey | XFXOLBNQYFRSLQ-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=CC=C2)=CC(N)=C1C(O)=O |
| CAS DataBase Reference | 5959-52-4(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Naphthalenecarboxylic acid, 3-amino- (5959-52-4) |
Description and Uses
3-Amino-2-naphthoic acid is a dyes analytical reagent which is used as an intermediate for organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| RTECS | QL1400000 |
| TSCA | Yes |
| HS Code | 29224999 |
