A0840612
5-Amino-2-benzimidazolinone , >98.0%(HPLC) , 95-23-8
CAS NO.：95-23-8
Empirical Formula: C7H7N3O
Molecular Weight: 149.15
MDL number: MFCD07366641
EINECS: 202-401-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB24.00 | In Stock |
|
| 100G | RMB107.20 | In Stock |
|
| 500g | RMB431.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C |
| Boiling point: | 201.4±19.0 °C(Predicted) |
| Density | 1.363±0.06 g/cm3(Predicted) |
| vapor pressure | 0.001Pa at 20℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | Powder |
| pka | 11.80±0.30(Predicted) |
| color | White to Amber to Dark purple |
| InChI | InChI=1S/C7H7N3O/c8-4-1-2-5-6(3-4)10-7(11)9-5/h1-3H,8H2,(H2,9,10,11) |
| InChIKey | BCXSVFBDMPSKPT-UHFFFAOYSA-N |
| SMILES | C1(=O)NC2=CC=C(N)C=C2N1 |
| LogP | -0.33 at 23℃ and pH6.5-7.5 |
| CAS DataBase Reference | 95-23-8(CAS DataBase Reference) |
| EPA Substance Registry System | 2H-Benzimidazol-2-one, 5-amino-1,3-dihydro- (95-23-8) |
Description and Uses
5-Amino-2-hydroxybenzimidazole is an important reagent in the discovery of potent and selective non-nucleotide small molecule inhibitors of CD73
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-36-22 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933998090 |
