A0844112
5-Azidovaleric Acid , 95% , 79583-98-5
Synonym(s):
5-Azidovalerianic acid
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB454.40 | In Stock |
|
| 200MG | RMB1288.00 | In Stock |
|
| 250mg | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 85°C/0.01mmHg(lit.) |
| Density | 1.142 |
| refractive index | 1.4640-1.4680 |
| storage temp. | -20°C |
| solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; Ethanol: 30 mg/ml; PBS (pH 7.2): 10 mg/ml |
| form | clear liquid |
| color | Colorless to Red to Green |
| BRN | 1706398 |
| InChI | InChI=1S/C5H9N3O2/c6-8-7-4-2-1-3-5(9)10/h1-4H2,(H,9,10) |
| InChIKey | SBZDIRMBQJDCLB-UHFFFAOYSA-N |
| SMILES | C(C(O)=O)CCCN=[N+]=[N-] |
Description and Uses
5-Azidopentanoic acid can be used to synthesize:
- Chitosan-poly(ethylene glycol) hydrogels by azide–alkyne click chemistry.
- 5-iodo-1,2,3-triazole containing macrocycles.
- Bivalent quinine dimers intervening triazole ring used as inhibitors of P-glycoprotein (P-gp) mediated cellular efflux.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS08 |
| Signal word | Danger |
| Hazard statements | H242-H350 |
| Precautionary statements | P202-P210-P235-P308+P313-P370+P378-P403 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 40 |
| Safety Statements | 36/37 |
| WGK Germany | 3 |
| HS Code | 29299090 |
| Storage Class | 5.2 - Organic peroxides and self-reacting hazardous materials |
| Hazard Classifications | Carc. 1B Self-react. C |






