A0846412
2-Amino-4-methoxybenzothiazole , >98.0%(HPLC) , 5464-79-9
CAS NO.:5464-79-9
Empirical Formula: C8H8N2OS
Molecular Weight: 180.23
MDL number: MFCD00005792
EINECS: 226-763-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB187.20 | In Stock |
|
| 5G | RMB481.60 | In Stock |
|
| 25g | RMB1708.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 153-155 °C (lit.) |
| Boiling point: | 240°C (rough estimate) |
| Density | 1.2425 (rough estimate) |
| refractive index | 1.5690 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 4.09±0.10(Predicted) |
| form | Crystalline Powder |
| color | Beige |
| Water Solubility | <0.1 g/100 mL at 19.5 ºC |
| BRN | 141363 |
| InChI | InChI=1S/C8H8N2OS/c1-11-5-3-2-4-6-7(5)10-8(9)12-6/h2-4H,1H3,(H2,9,10) |
| InChIKey | YEBCRAVYUWNFQT-UHFFFAOYSA-N |
| SMILES | S1C2=CC=CC(OC)=C2N=C1N |
| CAS DataBase Reference | 5464-79-9(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Amino-4-methoxybenzothiazole (5464-79-9) |
Description and Uses
2-Amino-4-methoxybenzothiazole is a useful research intermediate for the synthesis of various benzothiazole and aminobenzothiazoles derivatives with antibacterial and antifungal activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22 |
| Safety Statements | 36 |
| WGK Germany | 3 |
| RTECS | DL2000000 |
| Hazard Note | Harmful |
| HS Code | 29342000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |




