A0847112
2-Aminoperimidine Hydrobromide [Precipitation reagent for SO<sub>4</sub>] , >97.0%(T) , 40835-96-9
CAS NO.:40835-96-9
Empirical Formula: C11H10BrN3
Molecular Weight: 264.12
MDL number: MFCD00012749
EINECS: 255-101-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB712.80 | In Stock |
|
| 25G | RMB2484.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 295-300 °C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Light yellow to Dark green |
| BRN | 3570810 |
| InChI | InChI=1S/C11H9N3.BrH/c12-11-13-8-5-1-3-7-4-2-6-9(14-11)10(7)8;/h1-6H,(H3,12,13,14);1H |
| InChIKey | HFZUTZWRTHBWPV-UHFFFAOYSA-N |
| SMILES | C12C3C=CC=C1N=C(N)NC=2C=CC=3.Br |
| CAS DataBase Reference | 40835-96-9(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | 3 |
| F | 8-10-23 |
| HS Code | 2925.29.9000 |

![2-Aminoperimidine Hydrobromide [Precipitation reagent for SO<sub>4</sub>]](https://img.chemicalbook.com/CAS/GIF/40835-96-9.gif)


![Potassium Tetrakis(4-chlorophenyl)borate [Anion for the neutral carrier type ion electrode]](https://img.chemicalbook.com/CAS/GIF/14680-77-4.gif)


