A0849112
4-Amino-2-chlorophenol , >98.0%(GC) , 3964-52-1
Synonym(s):
3-Chloro-4-hydroxyaniline
| Pack Size | Price | Stock | Quantity |
| 1G | RMB71.20 | In Stock |
|
| 5G | RMB239.20 | In Stock |
|
| 25G | RMB799.20 | In Stock |
|
| 100G | RMB2559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 150-153 °C(lit.) |
| Boiling point: | 292.7±25.0 °C(Predicted) |
| Density | 1.406±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 8.75±0.18(Predicted) |
| form | Solid |
| color | Dark Brown |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C6H6ClNO/c7-5-3-4(8)1-2-6(5)9/h1-3,9H,8H2 |
| InChIKey | ZYZQSCWSPFLAFM-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(N)C=C1Cl |
| CAS DataBase Reference | 3964-52-1(CAS DataBase Reference) |
Description and Uses
4-Amino-2-chlorophenol may be used in the synthesis of the following compounds:
- N-(3-chloro-4-hydroxyphenyl)-N′,N′-dimethylurea
- 1,4-diketo-3-((4-[N-(3-chloro-4-hydroxyphenyl)amino]sulfonyl)phenyl)-6-phenylpyrrolo[3,4-c]pyrrole, a novel fluorescent pH-indicator
- 4-(4-aminophenoxy)-N-(4-(4-aminophenoxy) benzylidene)-3-chloroaniline
- 4-(4-amino-3-methylphenoxy)-N-(4-(4-amino-3-methylphenoxy)benzylidene)-3-chloroaniline
- 4-(4-amino-2-methylphenoxy)-N-(4-(4-amino-2-methylphenoxy)benzylidene)-3-chloroaniline
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29222900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




