A0849612
8-Amino-2-methylquinoline , >97.0%(GC) , 18978-78-4
CAS NO.：18978-78-4
Empirical Formula: C10H10N2
Molecular Weight: 158.2
MDL number: MFCD00023998
EINECS: 606-190-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB28.80 | In Stock |
|
| 1G | RMB52.00 | In Stock |
|
| 5G | RMB150.40 | In Stock |
|
| 25g | RMB429.60 | In Stock |
|
| 100g | RMB1384.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 56-58°C |
| Boiling point: | 316.6±27.0 °C(Predicted) |
| Density | 1.169±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | pK1: 4.86(+1) (25°C) |
| color | White to Amber to Dark green |
| InChI | InChI=1S/C10H10N2/c1-7-5-6-8-3-2-4-9(11)10(8)12-7/h2-6H,11H2,1H3 |
| InChIKey | JHIAOWGCGNMQKA-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=CC=2N)C=CC=1C |
| CAS DataBase Reference | 18978-78-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 8-Aminoquinaldine(18978-78-4) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 20/21/22-41 |
| Safety Statements | 22-36/37/39-39-26 |
| HazardClass | IRRITANT |
| HS Code | 29334900 |
