A0850112
2-Amino-5-nitrophenol , >98.0%(HPLC) , 121-88-0
Synonym(s):
5-Nitro-2-aminophenol;2-Hydroxy-4-nitroaniline;3-Hydroxy-4-aminonitrobenzene;3-Nitro-6-aminophenol;5-Nitro-2-amino-1-hydroxybenzene
CAS NO.：121-88-0
Empirical Formula: C6H6N2O3
Molecular Weight: 154.12
MDL number: MFCD00007692
EINECS: 204-503-8
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 198-202 °C (dec.) (lit.) |
| Boiling point: | 322.46°C (rough estimate) |
| Density | 1.3617 (estimate) |
| refractive index | 1.6890 (rough estimate) |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 8.08±0.19(Predicted) |
| form | Crystalline Powder |
| color | Rust brown to brown |
| Water Solubility | insoluble |
| BRN | 972974 |
| Henry's Law Constant | 1.3×107 mol/(m3Pa) at 25℃, HSDB (2015) |
| Cosmetics Ingredients Functions | HAIR DYEING |
| Cosmetic Ingredient Review (CIR) | 2-Amino-5-nitrophenol (121-88-0) |
| InChI | InChI=1S/C6H6N2O3/c7-5-2-1-4(8(10)11)3-6(5)9/h1-3,9H,7H2 |
| InChIKey | DOPJTDJKZNWLRB-UHFFFAOYSA-N |
| SMILES | C1(O)=CC([N+]([O-])=O)=CC=C1N |
| CAS DataBase Reference | 121-88-0(CAS DataBase Reference) |
| IARC | 3 (Vol. 57) 1993 |
| EPA Substance Registry System | 2-Amino-5-nitrophenol (121-88-0) |
Description and Uses
Reactant for:• ;Diazotation and coupling reactions1• ;Preparation of biologically and pharmacologically active molecules2
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-68-20/21/22 |
| Safety Statements | 26-36/37-45-36/37/39-36 |
| RIDADR | 2811 |
| WGK Germany | 2 |
| RTECS | SJ6302500 |
| TSCA | TSCA listed |
| HS Code | 29222900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 121-88-0(Hazardous Substances Data) |
| Toxicity | LD50 oral in rat: > 4gm/kg |
