A0854312
Allyltris(trimethylsilyloxy)silane , >96.0%(GC) , 7087-21-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB111.20 | In Stock |
|
| 1G | RMB271.20 | In Stock |
|
| 5G | RMB950.40 | In Stock |
|
| 25g | RMB3199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <0°C |
| Boiling point: | 105 °C |
| Density | 0.86 |
| refractive index | 1.4008 |
| Flash point: | 153°C |
| storage temp. | 2-8°C, stored under nitrogen |
| Water Solubility | Insoluble in water |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 0.86 |
| Hydrolytic Sensitivity | 2: reacts with aqueous acid |
| InChI | InChI=1S/C12H32O3Si4/c1-11-12-19(13-16(2,3)4,14-17(5,6)7)15-18(8,9)10/h11H,1,12H2,2-10H3 |
| InChIKey | WCAXVXQTTCIZHD-UHFFFAOYSA-N |
| SMILES | [Si](C)(C)(C)O[Si](CC=C)(O[Si](C)(C)C)O[Si](C)(C)C |
| CAS DataBase Reference | 7087-21-0 |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H227-H315-H319 |
| Precautionary statements | P210-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P370+P378-P403+P235-P501 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| TSCA | No |
| HS Code | 2931.90.9010 |
