A0855312
7-Aminoheptanoic Acid , >98.0%(T) , 929-17-9
Synonym(s):
7-Aminooenanthic acid
CAS NO.:929-17-9
Empirical Formula: C7H15NO2
Molecular Weight: 145.2
MDL number: MFCD00008242
EINECS: 213-197-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB31.20 | In Stock |
|
| 1G | RMB62.40 | In Stock |
|
| 5G | RMB184.00 | In Stock |
|
| 25G | RMB771.20 | In Stock |
|
| 100g | RMB2791.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 192-195 °C (lit.) |
| Boiling point: | 270.6±23.0 °C(Predicted) |
| Density | 1.019±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| Water Solubility | Soluble in water |
| pka | pK1: 4.502 (25°C) |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 906887 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C7H15NO2/c8-6-4-2-1-3-5-7(9)10/h1-6,8H2,(H,9,10) |
| InChIKey | XDOLZJYETYVRKV-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCCCCCN |
| CAS DataBase Reference | 929-17-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 7-Aminoheptanoic acid(929-17-9) |
Description and Uses
7-Aminoheptanoic Acid is an aliphatic ω-amino acid that acts as a ligand for recombinant kringle 2 domain (residues 180-261) of human tissue-type plasminogen.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 2 |
| RTECS | MJ1770000 |
| HS Code | 2922498590 |
| Storage Class | 11 - Combustible Solids |
| REACH Registrations | Active |




