A0855912
α-Ionone , >90.0%(GC) , 127-41-3
Synonym(s):
4-(2,6,6-Trimethyl-2-cyclohexenyl)-3-buten-2-one;alpha-Ionone
CAS NO.:127-41-3
Empirical Formula: C13H20O
Molecular Weight: 192.3
MDL number: MFCD00001565
EINECS: 204-841-6
| Pack Size | Price | Stock | Quantity |
| 5g | RMB29.60 | In Stock |
|
| 25G | RMB72.00 | In Stock |
|
| 100G | RMB209.60 | In Stock |
|
| 500G | RMB594.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 25°C |
| Boiling point: | 259-263 °C(lit.) |
| Density | 0.93 g/mL at 25 °C(lit.) |
| vapor pressure | 0.133Pa |
| refractive index | n |
| FEMA | 2594 | ALPHA-IONONE |
| Flash point: | 230 °F |
| storage temp. | 2-8°C |
| solubility | Soluble in ethanol fixed oils, propylene glycol. Slightly soluble in alcohol, ether, mineral oil. |
| form | Oil |
| color | Clear Colourless |
| Odor | at 10.00 % in dipropylene glycol. sweet woody floral violet orris tropical fruity |
| Odor Type | floral |
| biological source | synthetic |
| Water Solubility | insoluble |
| Merck | 14,5056 |
| JECFA Number | 388 |
| BRN | 2046084 |
| Dielectric constant | 11.0(18℃) |
| Major Application | cleaning products cosmetics flavors and fragrances food and beverages personal care |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C13H20O/c1-10-6-5-9-13(3,4)12(10)8-7-11(2)14/h6-8,12H,5,9H2,1-4H3/b8-7+ |
| InChIKey | UZFLPKAIBPNNCA-BQYQJAHWSA-N |
| SMILES | CC(=O)\C=C\C1C(C)=CCCC1(C)C |
| LogP | 3.85 at 37℃ |
| CAS DataBase Reference | 127-41-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Buten-2-one, 4-(2,6,6-trimethyl-2-cyclohexen-1-yl)-, (E)-(127-41-3) |
| EPA Substance Registry System | .alpha.-Ionone (127-41-3) |
Description and Uses
α-Ionone has a characteristic violet-like odor. α-Ionone may be prepared by condensing citral with acetone to form pseudoionone, which is then cyclized by acid-type reagents.
An aroma compound commonly found in essential oils such as rose oil. It is a degradation products of caratenoids produced by caratenoid cleavage dioxygenases (CCD).
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H334 |
| Precautionary statements | P261-P342+P311 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 42-36-36/37/38 |
| Safety Statements | 36-24/25-26-36/37/39-27 |
| WGK Germany | 2 |
| RTECS | EN0525000 |
| TSCA | TSCA listed |
| HS Code | 29142300 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Resp. Sens. 1 |
| Hazardous Substances Data | 127-41-3(Hazardous Substances Data) |




