A0862512
Acetamidoxime , >97.0%(GC) , 22059-22-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB28.80 | In Stock |
|
| 5G | RMB103.20 | In Stock |
|
| 25G | RMB423.20 | In Stock |
|
| 100g | RMB1285.60 | In Stock |
|
| 500g | RMB7999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 134 °C |
| Boiling point: | 110.6±23.0 °C(Predicted) |
| Density | 1.19±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| pka | 7.48±0.69(Predicted) |
| form | Powder, Crystals and/or Chunks |
| color | White |
| InChI | InChI=1S/C2H6N2O/c1-2(3)4-5/h5H,1H3,(H2,3,4) |
| InChIKey | AEXITZJSLGALNH-UHFFFAOYSA-N |
| SMILES | C(NO)(=N)C |
Description and Uses
N-Hydroxyacetamidine is a useful research chemical used in the preparation of amidoximes and related compounds.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P501 |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36/37/39-37/39 |
| RTECS | AC6900000 |
| HazardClass | IRRITANT |
| HS Code | 29280000 |
