A0862912
Azoic Diazo Component 20 (Base) , >95.0%(T) , 120-00-3
Synonym(s):
4′-Amino-2′,5′-diethoxybenzanilide;Azoic Diazo No. 20;Fast blue BB
CAS NO.：120-00-3
Empirical Formula: C17H20N2O3
Molecular Weight: 300.35
MDL number: MFCD00009091
EINECS: 204-363-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB31.20 | In Stock |
|
| 25G | RMB298.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 98-100 °C |
| Boiling point: | 441.58°C (rough estimate) |
| Density | 1.0943 (rough estimate) |
| refractive index | 1.5486 (estimate) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| Colour Index | 37175 |
| form | Powder or Chunks |
| pka | 12.12±0.70(Predicted) |
| color | Gray to brown |
| BRN | 3416889 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C17H20N2O3/c1-3-21-15-11-14(16(22-4-2)10-13(15)18)19-17(20)12-8-6-5-7-9-12/h5-11H,3-4,18H2,1-2H3,(H,19,20) |
| InChIKey | CNXZLZNEIYFZGU-UHFFFAOYSA-N |
| SMILES | CCOc1cc(NC(=O)c2ccccc2)c(OCC)cc1N |
| Dissociation constant | 0 at 22℃ |
| EPA Substance Registry System | Benzamide, N-(4-amino-2,5-diethoxyphenyl)- (120-00-3) |
Description and Uses
Fast Blue BB is a component used in assays that detect virus in clinical specimen. It is also used in test kits that detect micro-organisms infection. Dyes and metabolites.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315 |
| Precautionary statements | P302+P352 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38-41-37/38 |
| Safety Statements | 37/39-26-36/37/39 |
| RIDADR | UN 1789 8/PG 2 |
| WGK Germany | 1 |
| TSCA | TSCA listed |
| HS Code | 29242998 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Irrit. 2 |
