A0870312
4-Amino-3-nitrobenzoic Acid , >95.0%(HPLC) , 1588-83-6
CAS NO.：1588-83-6
Empirical Formula: C7H6N2O4
Molecular Weight: 182.13
MDL number: MFCD00017009
EINECS: 216-453-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB68.80 | In Stock |
|
| 100G | RMB214.40 | In Stock |
|
| 500G | RMB950.40 | In Stock |
|
| 250g | RMB1167.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 280 °C (dec.) (lit.) |
| Boiling point: | 315.51°C (rough estimate) |
| Density | 1.5181 (rough estimate) |
| refractive index | 1.5880 (estimate) |
| Flash point: | 290°C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Crystalline Powder |
| pka | 4.19±0.10(Predicted) |
| color | Ochre to yellow |
| Decomposition | 290 ºC |
| BRN | 645206 |
| InChI | InChI=1S/C7H6N2O4/c8-5-2-1-4(7(10)11)3-6(5)9(12)13/h1-3H,8H2,(H,10,11) |
| InChIKey | ZZNAYFWAXZJITH-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(N)C([N+]([O-])=O)=C1 |
| CAS DataBase Reference | 1588-83-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoic acid, 4-amino-3-nitro-(1588-83-6) |
| EPA Substance Registry System | Benzoic acid, 4-amino-3-nitro- (1588-83-6) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| TSCA | Yes |
| HazardClass | IRRITANT |
| HS Code | 29224999 |
