A0870612
3-Amino-5-(trifluoromethyl)benzoic Acid , >97.0%(HPLC)(T) , 328-68-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB78.40 | In Stock |
|
| 5G | RMB263.20 | In Stock |
|
| 25G | RMB876.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 141-146 °C(lit.) |
| Boiling point: | 331.9±42.0 °C(Predicted) |
| Density | 1.489±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 3.93±0.10(Predicted) |
| form | powder to crystal |
| color | Light yellow to Yellow to Orange |
| Major Application | peptide synthesis |
| InChI | 1S/C8H6F3NO2/c9-8(10,11)5-1-4(7(13)14)2-6(12)3-5/h1-3H,12H2,(H,13,14) |
| InChIKey | WBTHOSZMTIPJLR-UHFFFAOYSA-N |
| SMILES | Nc1cc(cc(c1)C(F)(F)F)C(O)=O |
| CAS DataBase Reference | 328-68-7(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | DD6205700 |
| HazardClass | IRRITANT |
| HS Code | 2934999090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
