A0880412
2-Amino-3-benzyloxypyridine , >98.0%(GC) , 24016-03-3
CAS NO.:24016-03-3
Empirical Formula: C12H12N2O
Molecular Weight: 200.24
MDL number: MFCD00006316
EINECS: 245-983-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB50.40 | In Stock |
|
| 25G | RMB150.40 | In Stock |
|
| 100G | RMB396.80 | In Stock |
|
| 500g | RMB1666.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 92-94 °C (lit.) |
| Boiling point: | 337.96°C (rough estimate) |
| Density | 1.1131 (rough estimate) |
| refractive index | 1.6660 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 8.40±0.10(Predicted) |
| form | Crystalline Powder |
| color | Green to brown |
| BRN | 392674 |
| InChI | InChI=1S/C12H12N2O/c13-12-11(7-4-8-14-12)15-9-10-5-2-1-3-6-10/h1-8H,9H2,(H2,13,14) |
| InChIKey | NMCBWICNRJLKKM-UHFFFAOYSA-N |
| SMILES | C1(N)=NC=CC=C1OCC1=CC=CC=C1 |
| CAS DataBase Reference | 24016-03-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Pyridinamine, 3-(phenylmethoxy)-(24016-03-3) |
Description and Uses
2-Amino-3-benzyloxypyridine was used in the synthesis of 1-acetyl-2-[2-(3-benzyloxypyridinyl)]iminoimidazolidine.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-37/39-24/25-36/37/39-22,26-36 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29221985 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



