A0881412
2-Amino-3,5-dibromopyridine , >98.0%(GC) , 35486-42-1
CAS NO.:35486-42-1
Empirical Formula: C5H4Br2N2
Molecular Weight: 251.91
MDL number: MFCD00038041
EINECS: 252-590-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB49.60 | In Stock |
|
| 100G | RMB143.20 | In Stock |
|
| 500g | RMB583.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 104-105 °C (lit.) |
| Boiling point: | 253.9±35.0 °C(Predicted) |
| Density | 2.147±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 1.89±0.49(Predicted) |
| Appearance | Light yellow to yellow Solid |
| BRN | 119390 |
| InChI | InChI=1S/C5H4Br2N2/c6-3-1-4(7)5(8)9-2-3/h1-2H,(H2,8,9) |
| InChIKey | WJMJWMSWJSACSN-UHFFFAOYSA-N |
| SMILES | C1(N)=NC=C(Br)C=C1Br |
| CAS DataBase Reference | 35486-42-1(CAS DataBase Reference) |
Description and Uses
The synthesis of 2-amino-3,5-dibromopyridine complexes and their analysis by single crystal X-ray diffraction has been studied.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P305+P351+P338-P280a-P304+P340-P405-P501a |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







