A0882912
5-Amino-2-naphthalenesulfonic Acid , >97.0%(T) , 119-79-9
CAS NO.:119-79-9
Empirical Formula: C10H9NO3S
Molecular Weight: 223.25
MDL number: MFCD00004030
EINECS: 204-351-2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB23.20 | In Stock |
|
| 25G | RMB113.60 | In Stock |
|
| 100G | RMB144.80 | In Stock |
|
| 250g | RMB204.80 | In Stock |
|
| 500G | RMB287.20 | In Stock |
|
| 2.5kg | RMB1007.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300°C |
| Density | 1.3588 (rough estimate) |
| vapor pressure | 0Pa at 25℃ |
| refractive index | 1.6500 (estimate) |
| storage temp. | Refrigerator |
| solubility | soluble100mg/mL, clear, brown (1N NH4OH) |
| pka | pK1: 3.80 (25°C) |
| form | Solid |
| color | Purple |
| Water Solubility | 1g/L(16 ºC) |
| Merck | 14,2350 |
| BRN | 1819887 |
| InChI | 1S/C10H9NO3S/c11-10-3-1-2-7-6-8(15(12,13)14)4-5-9(7)10/h1-6H,11H2,(H,12,13,14) |
| InChIKey | UWPJYQYRSWYIGZ-UHFFFAOYSA-N |
| SMILES | Nc1cccc2cc(ccc12)S(O)(=O)=O |
| Dissociation constant | 0 at 39℃ |
| CAS DataBase Reference | 119-79-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-Naphthylamine-6-sulfonic acid(119-79-9) |
| EPA Substance Registry System | 2-Naphthalenesulfonic acid, 5-amino- (119-79-9) |
Description and Uses
Intermediate of dyestuff
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-24/25 |
| RIDADR | 1759 |
| WGK Germany | 1 |
| RTECS | QK1285000 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |






