A0885112
3-Aminobenzenesulfonamide , >98.0%(HPLC)(T) , 98-18-0
CAS NO.:98-18-0
Empirical Formula: C6H8N2O2S
Molecular Weight: 172.2
MDL number: MFCD00035781
EINECS: 202-646-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB36.00 | In Stock |
|
| 25G | RMB121.60 | In Stock |
|
| 100G | RMB398.40 | In Stock |
|
| 500G | RMB1795.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 139 °C |
| Boiling point: | 420.7±47.0 °C(Predicted) |
| Density | 1.303 (estimate) |
| refractive index | 1.6490 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Practically insoluble[in water] |
| form | solid |
| pka | 10.34±0.60(Predicted) |
| color | White to Light red to Green |
| Water Solubility | 11.96g/L(24 ºC) |
| InChI | InChI=1S/C6H8N2O2S/c7-5-2-1-3-6(4-5)11(8,9)10/h1-4H,7H2,(H2,8,9,10) |
| InChIKey | JPVKCHIPRSQDKL-UHFFFAOYSA-N |
| SMILES | C1(S(N)(=O)=O)=CC=CC(N)=C1 |
| CAS DataBase Reference | 98-18-0(CAS DataBase Reference) |
| NIST Chemistry Reference | m-Aminobenzenesulfonamide(98-18-0) |
| EPA Substance Registry System | Benzenesulfonamide, 3-amino- (98-18-0) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | OY2200000 |
| Hazard Note | Harmful/Irritant |
| TSCA | TSCA listed |
| HS Code | 29350090 |
| Storage Class | 13 - Non Combustible Solids |





