5-Amino-2,4,6-triiodoisophthaloyl Dichloride , 98% , 37441-29-5
CAS NO.:37441-29-5
Empirical Formula: C8H2Cl2I3NO2
Molecular Weight: 595.73
MDL number: MFCD00270836
EINECS: 417-220-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB103.20 | In Stock |
|
| 5G | RMB344.00 | In Stock |
|
| 25G | RMB1439.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 231°C(lit.) |
| Boiling point: | 566.9±50.0 °C(Predicted) |
| Density | 2.826±0.06 g/cm3(Predicted) |
| vapor pressure | 0.018Pa at 20℃ |
| storage temp. | Refrigerator, under inert atmosphere |
| solubility | Acetone (Slightly), Methanol (Very Slightly) |
| pka | -3.45±0.10(Predicted) |
| form | Solid |
| color | Yellow toDark Brown |
| λmax | 233nm(MeOH)(lit.) |
| InChI | InChI=1S/C8H2Cl2I3NO2/c9-7(15)1-3(11)2(8(10)16)5(13)6(14)4(1)12/h14H2 |
| InChIKey | FBJVWRITWDYUAC-UHFFFAOYSA-N |
| SMILES | C1(C(Cl)=O)=C(I)C(N)=C(I)C(C(Cl)=O)=C1I |
| LogP | 3.7 at 20℃ |
| CAS DataBase Reference | 37441-29-5(CAS DataBase Reference) |
Description and Uses
5-Amino-2,4,6-triiodoisophthaloyl dichloride is a triiodinated compound that has been shown to bind to the receptor for asialoglycoprotein. It is used in the diagnosis of liver and kidney diseases. 5-Amino-2,4,6-triiodisophthaloyl acid dichloride is taken up by tissues and organs and causes damage to these tissues. The chloride ion binds to the molecule, making it more water soluble. The lactobionic acid residue is then cleaved off by an enzyme in the cell called beta-galactosidase. This leaves a molecule containing iodine which can be detected with a diagnostic technique such as X-ray crystallography or nuclear magnetic resonance spectroscopy.
5-Amino-2,4,6- triiodisophthaloyl acid dichloride is used in the preparation of trimeric X-ray contrast agents.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H317-H319-H411 |
| Precautionary statements | P261-P264-P272-P273-P280-P302+P352+P333+P313+P363-P305+P351+P338+P337+P313-P391-P501 |
| Hazard Codes | Xi,N |
| Risk Statements | 43-51/53 |
| Safety Statements | 22-36/37-61 |
| RIDADR | 3077 |
| HS Code | 2922.49.3700 |
| HazardClass | 9 |
| PackingGroup | III |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






