A0887112
4-Amino-3-chlorobenzotrifluoride , >97.0%(GC) , 39885-50-2
Synonym(s):
4-Amino-3-chlorobenzotrifluoride
CAS NO.:39885-50-2
Empirical Formula: C7H5ClF3N
Molecular Weight: 195.57
MDL number: MFCD00042563
EINECS: 254-674-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB47.20 | In Stock |
|
| 25G | RMB143.20 | In Stock |
|
| 100G | RMB480.80 | In Stock |
|
| 500g | RMB2131.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 214-218 °C(lit.) |
| Density | 1.4160 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 218 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 0.82±0.10(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow |
| BRN | 4179703 |
| InChI | InChI=1S/C7H5ClF3N/c8-5-3-4(7(9,10)11)1-2-6(5)12/h1-3H,12H2 |
| InChIKey | MBBUTABXEITVNY-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(C(F)(F)F)C=C1Cl |
| CAS DataBase Reference | 39885-50-2(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301+H311-H315-H319-H332-H335-H400 |
| Precautionary statements | P273-P280-P301+P310+P330-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,Xn,N,T |
| Risk Statements | 36/37/38-20/21/22-50-24-20/22 |
| Safety Statements | 26-36-36/37/39-23-61-45 |
| RIDADR | UN2810 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Oral Acute Tox. 4 Inhalation Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







