A0889612
2-Amino-3-methyl-5-nitropyridine , 98% , 18344-51-9
CAS NO.：18344-51-9
Empirical Formula: C6H7N3O2
Molecular Weight: 153.14
MDL number: MFCD03095060
EINECS: 623-204-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB43.20 | In Stock |
|
| 1G | RMB51.12 | In Stock |
|
| 25g | RMB134.40 | In Stock |
|
| 100g | RMB463.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 256-260 °C |
| Boiling point: | 276.04°C (rough estimate) |
| Density | 1.3682 (rough estimate) |
| refractive index | 1.6500 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder to crystal |
| pka | 3.13±0.49(Predicted) |
| color | Light yellow to Yellow to Orange |
| BRN | 126947 |
| InChI | InChI=1S/C6H7N3O2/c1-4-2-5(9(10)11)3-8-6(4)7/h2-3H,1H3,(H2,7,8) |
| InChIKey | JLPYUDJJBGYXEZ-UHFFFAOYSA-N |
| SMILES | C1(N)=NC=C([N+]([O-])=O)C=C1C |
| CAS DataBase Reference | 18344-51-9(CAS DataBase Reference) |
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P280-P301+P312+P330-P305+P351+P338+P310 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-20/21/22-41-22 |
| Safety Statements | 36/37/39-26-22-39-36-37 |
| RIDADR | UN2811 |
| WGK Germany | 1 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
