PRODUCT Properties
| Melting point: | 127-128°C |
| Boiling point: | 334.29°C (rough estimate) |
| Density | 1.3145 (rough estimate) |
| vapor pressure | 0Pa at 20℃ |
| refractive index | 1.7400 (estimate) |
| storage temp. | 2-8°C, protect from light |
| pka | 14.60±0.10(Predicted) |
| form | powder to crystal |
| color | Amber to Dark green to Black |
| Water Solubility | <0.01 g/100 mL at 18 ºC |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C8H11N3O3/c9-6-1-2-7(10-3-4-12)8(5-6)11(13)14/h1-2,5,10,12H,3-4,9H2 |
| InChIKey | GZGZVOLBULPDFD-UHFFFAOYSA-N |
| SMILES | C(O)CNC1=CC=C(N)C=C1[N+]([O-])=O |
| LogP | 0.27 at 20℃ |
| CAS DataBase Reference | 2871-01-4(CAS DataBase Reference) |
| IARC | 3 (Vol. 57) 1993 |
| EPA Substance Registry System | HC Red No. 3 (2871-01-4) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P261-P280 |
| RTECS | KJ6500000 |
| HS Code | 2922.19.7000 |
| Hazardous Substances Data | 2871-01-4(Hazardous Substances Data) |
