A0895412
Aluminum <i>tert</i>-Butoxide , >97.0% , 556-91-2
Synonym(s):
Aluminum-tri-tert-butoxide
CAS NO.:556-91-2
Empirical Formula: C12H27AlO3
Molecular Weight: 246.32
MDL number: MFCD00008801
EINECS: 209-146-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB75.20 | In Stock |
|
| 5G | RMB221.60 | In Stock |
|
| 25g | RMB863.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 241°C |
| Boiling point: | 156°C 2mm |
| Density | 1,0251 g/cm3 |
| Flash point: | >65°C |
| solubility | Very soluble in organic solvents like alcohols, benzene, toluene and xylene. |
| form | Powder |
| color | White to Gray |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Sensitive | Moisture Sensitive |
| Merck | 14,333 |
| BRN | 4148229 |
| Stability: | Stable, but air and moisture sensitive. Incompatible with acids, strong oxidizing agents. Highly flammable. |
| InChI | 1S/3C4H9O.Al/c3*1-4(2,3)5;/h3*1-3H3;/q3*-1;+3 |
| InChIKey | MDDPTCUZZASZIQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)O[Al](OC(C)(C)C)OC(C)(C)C |
| CAS DataBase Reference | 556-91-2(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Propanol, 2-methyl-, aluminum salt (556-91-2) |
Description and Uses
Reagent for oxidation of alcohols to ketones; in dealcoholation of orthoesters.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H228-H314 |
| Precautionary statements | P210-P240-P260-P280-P303+P361+P353-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | F,C |
| Risk Statements | 11-34 |
| Safety Statements | 8-16-26-36/37/39-45 |
| RIDADR | UN 2925 4.1/PG 2 |
| WGK Germany | 3 |
| F | 8-21 |
| TSCA | TSCA listed |
| HazardClass | 4.1 |
| PackingGroup | III |
| HS Code | 29051990 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Flam. Sol. 1 Skin Corr. 1B |
| Limited Quantities | 1.0 Kg (2.2 lbs) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |






