A0925212
4-<WBR>aminopyridine-<WBR>2-<WBR>carboxylic acid , 97% , 100047-36-7
CAS NO.：100047-36-7
Empirical Formula: C6H6N2O2
Molecular Weight: 138.12
MDL number: MFCD02685671
EINECS: 687-925-9
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB111.20 | In Stock |
|
| 1G | RMB211.20 | In Stock |
|
| 5G | RMB589.60 | In Stock |
|
| 25G | RMB2764.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 265 °C |
| Boiling point: | 446.3±30.0 °C(Predicted) |
| Density | 1.417±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | Acetone, Ethanol, Methanol |
| form | Solid |
| pka | 1.37±0.50(Predicted) |
| Appearance | Off-white to yellow Solid |
| InChI | InChI=1S/C6H6N2O2/c7-4-1-2-8-5(3-4)6(9)10/h1-3H,(H2,7,8)(H,9,10) |
| InChIKey | JRZBTJVSAANBEV-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=NC=CC(N)=C1 |
| CAS DataBase Reference | 100047-36-7(CAS DataBase Reference) |
Description and Uses
4-Aminopyridine-2-carboxylic acid is an organic synthetic reagent used in the preparation of 4-amino-6-(heterocyclic)pyridine carboxylic acid esters, 4-amino-2,6-dimethylnicotinic acid esters and amides.
4-Aminopyridine-2-carboxylic acid can be a useful synthetic intermediate
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-36/37/38-20/21/22 |
| Safety Statements | 50A-24/25-36/37/39 |
| RIDADR | 2761 |
| Hazard Note | Irritant |
| HS Code | 29333990 |
