A0928912
Adefovir , 98%(HPLC) , 106941-25-7
Synonym(s):
GS 0393;GS-393;P-[[2-(6-Amino-9H-purin-9-yl)ethoxy]methyl]phosphonic acid, 9-(2-phosphonylmethoxyethyl)adenine;PMEA
CAS NO.:106941-25-7
Empirical Formula: C8H12N5O4P
Molecular Weight: 273.19
MDL number: MFCD00866943
EINECS: 600-789-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB38.40 | In Stock |
|
| 5G | RMB82.40 | In Stock |
|
| 25G | RMB297.60 | In Stock |
|
| 100G | RMB999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >260°C |
| Boiling point: | 632.5±65.0 °C(Predicted) |
| Density | 1.88 |
| storage temp. | -20°C |
| solubility | 0.1 M NaOH: ≥5mg/mL |
| pka | pKa1 2.0, pKa2 6.8(at 25℃) |
| form | powder |
| color | white to beige |
| InChI | InChI=1S/C8H12N5O4P/c9-7-6-8(11-3-10-7)13(4-12-6)1-2-17-5-18(14,15)16/h3-4H,1-2,5H2,(H2,9,10,11)(H2,14,15,16) |
| InChIKey | SUPKOOSCJHTBAH-UHFFFAOYSA-N |
| SMILES | P(COCCN1C2C(N=C1)=C(N)N=CN=2)(=O)(O)O |
| CAS DataBase Reference | 106941-25-7(CAS DataBase Reference) |
Description and Uses
Adefovir has been used to study its anti-retro viral effect on porcine endogenous retrovirus (PERV) activity.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310 |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 45 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | SZ6563500 |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| HS Code | 29339900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
| Hazardous Substances Data | 106941-25-7(Hazardous Substances Data) |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






![Propanoic acid, 2,2-dimethyl-, [[[[2-(6-amino-9H-purin-9-yl)ethoxy]methyl]ethoxyphosphinyl]oxy]methyl ester](https://img.chemicalbook.com/CAS/GIF/142341-04-6.gif)