A0946650
tetra-(4-pyridylphenyl)ethylene , 98% , 1227195-24-5
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB223.20 | In Stock |
|
| 200mg | RMB512.80 | In Stock |
|
| 250mg | RMB610.40 | In Stock |
|
| 1g | RMB1856.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 780.9±60.0 °C(Predicted) |
| Density | 1.187±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 6.20±0.10(Predicted) |
| Appearance | Light yellow to yellow Solid |
| InChIKey | DXNBXIFFCPRQAI-UHFFFAOYSA-N |
| SMILES | C(/C1=CC=C(C2C=CN=CC=2)C=C1)(\C1=CC=C(C2C=CN=CC=2)C=C1)=C(\C1=CC=C(C2C=CN=CC=2)C=C1)/C1=CC=C(C2C=CN=CC=2)C=C1 |
Description and Uses
Tetra-(4-pyridylphenyl)ethylene can be used as ligands in the synthesis of MOF materials: LMOF-241; LMOF-271; LMOF-261/262/263.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| HS Code | 29333990 |




![4',4''',4''''',4'''''''-(Ethene-1,1,2,2-tetrayl)tetrakis(([1,1'-biphenyl]-4-carbonitrile))](https://img.chemicalbook.com/CAS/20180629/GIF/608129-43-7.gif)
![4',4''',4''''',4'''''''-(Ethene-1,1,2,2-tetrayl)tetrakis(([1,1'-biphenyl]-4-ol))](https://img.chemicalbook.com/CAS/20200611/GIF/1712454-96-0.gif)

