A0987912
3-aminopyridine-2-carboxylic acid , 97% , 1462-86-8
CAS NO.：1462-86-8
Empirical Formula: C6H6N2O2
Molecular Weight: 138.12
MDL number: MFCD00090153
EINECS: 215-971-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB38.40 | In Stock |
|
| 5G | RMB162.40 | In Stock |
|
| 25G | RMB696.00 | In Stock |
|
| 100g | RMB2557.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 218-220 |
| Boiling point: | 386.6±27.0 °C(Predicted) |
| Density | 1.417±0.06 g/cm3(Predicted) |
| RTECS | US5175000 |
| storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| solubility | Soluble in acetone, ethanol and methanol. |
| form | Solid |
| pka | 1.32±0.50(Predicted) |
| color | Yellow to pale brown |
| InChI | InChI=1S/C6H6N2O2/c7-4-2-1-3-8-5(4)6(9)10/h1-3H,7H2,(H,9,10) |
| InChIKey | BOOMHTFCWOJWFO-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=NC=CC=C1N |
| CAS DataBase Reference | 1462-86-8(CAS DataBase Reference) |
Description and Uses
3-Amino-2-pyridinecarboxylic acid is a useful synthetic intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37-60 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
