A0991950
4-Methoxy-3-nitroaniline , ≥97% , 577-72-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB44.00 | In Stock |
|
| 5g | RMB150.40 | In Stock |
|
| 25g | RMB596.00 | In Stock |
|
| 100g | RMB2273.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 46-47 °C |
| Boiling point: | 356.9±22.0 °C(Predicted) |
| Density | 1.318±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly) |
| form | Solid |
| pka | 3.33±0.10(Predicted) |
| color | Dark Red |
| InChI | InChI=1S/C7H8N2O3/c1-12-7-3-2-5(8)4-6(7)9(10)11/h2-4H,8H2,1H3 |
| InChIKey | RUFOHZDEBFYQSV-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(OC)C([N+]([O-])=O)=C1 |
| CAS DataBase Reference | 577-72-0(CAS DataBase Reference) |
| NIST Chemistry Reference | P-anisidine, 3-nitro-,(577-72-0) |
Description and Uses
4-Methoxy-3-nitroaniline is a chemical compound that has been shown to have anti-tumor and anti-inflammatory effects. It belongs to the class of amines and can be synthesized by nitrating 4-methoxy aniline.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Hazard Note | Irritant |
| HS Code | 2922290090 |







