A1016312
3-Acetylpyrrole , 98% , 1072-82-8
CAS NO.：1072-82-8
Empirical Formula: C6H7NO
Molecular Weight: 109.13
MDL number: MFCD00067759
EINECS: 000-000-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB99.20 | In Stock |
|
| 1G | RMB153.60 | In Stock |
|
| 5g | RMB584.00 | In Stock |
|
| 10g | RMB1094.40 | In Stock |
|
| 25g | RMB2639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 115-117°C |
| Boiling point: | 220 C |
| Density | 1.099±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 15.37±0.50(Predicted) |
| color | Light Brown |
| BRN | 107151 |
| Stability: | Light Sensitive |
| InChI | InChI=1S/C6H7NO/c1-5(8)6-2-3-7-4-6/h2-4,7H,1H3 |
| InChIKey | KHHSXHXUQVNBGA-UHFFFAOYSA-N |
| SMILES | C(=O)(C1C=CNC=1)C |
| CAS DataBase Reference | 1072-82-8(CAS DataBase Reference) |
Description and Uses
3-Acetylpyrrole is a useful research reagent for organic synthesis and other chemical and pharmaceutical processes.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P280-P301+P312-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-36-22 |
| Safety Statements | 26-36/37/39-36 |
| Hazard Note | Irritant |
| HS Code | 2933998090 |
