A1029250
Zeatin , ≥98% , 13114-27-7
Synonym(s):
6-(4-Hydroxy-3-methylbut-2-enylamino)purine
CAS NO.：13114-27-7
Empirical Formula: C10H13N5O
Molecular Weight: 219.24
MDL number: MFCD00213654
EINECS: 999-999-2
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB159.20 | In Stock |
|
| 100mg | RMB279.20 | In Stock |
|
| 250mg | RMB559.20 | In Stock |
|
| 1g | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 209-211°C |
| Boiling point: | 395.0±52.0 °C(Predicted) |
| Density | 1.40±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | DMSO (Sparingly), Methanol (Slightly, Heated) |
| form | powder |
| pka | 14.55±0.10(Predicted) |
| color | off-white to yellow |
| InChI | InChI=1S/C10H13N5O/c1-7(4-16)2-3-11-9-8-10(13-5-12-8)15-6-14-9/h2,5-6,16H,3-4H2,1H3,(H2,11,12,13,14,15) |
| InChIKey | UZKQTCBAMSWPJD-FARCUNLSSA-N |
| SMILES | C(O)C(C)=CCNC1=C2C(=NC=N1)NC=N2 |
| CAS DataBase Reference | 13114-27-7 |
Description and Uses
Zeatin belongs to the family of plant-growth hormones called cytokinins and it can be used for agricultural use as agrochemicals for increasing crop yields and regulate various aspects of plant growth and development.
Safety
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
