A1032712
2-Aminothiophene-3-carboxamide , 98% , 14080-51-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB62.40 | In Stock |
|
| 5G | RMB230.40 | In Stock |
|
| 25G | RMB808.80 | In Stock |
|
| 100G | RMB2844.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 153-155°C |
| Boiling point: | 321.8±22.0 °C(Predicted) |
| Density | 1.423±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | powder to crystal |
| pka | 15.58±0.50(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C5H6N2OS/c6-4(8)3-1-2-9-5(3)7/h1-2H,7H2,(H2,6,8) |
| InChIKey | WHZIZZOTISTHCT-UHFFFAOYSA-N |
| SMILES | C1(N)SC=CC=1C(N)=O |
| CAS DataBase Reference | 14080-51-4(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H317-H319 |
| Precautionary statements | P261-P264-P280-P301+P310-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-36-43 |
| Safety Statements | 26-36/37 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| HS Code | 2934999090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Sens. 1 |




![ETHYL 5-METHYL-4-OXO-3,4-DIHYDROTHIENO[2,3-D]-PYRIMIDINE-6-CARBOXYLATE](https://img.chemicalbook.com/CAS/GIF/17417-67-3.gif)


