A1050612
2-Amino-1-cyclopentene-1-carbonitrile , 98% , 2941-23-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB36.00 | In Stock |
|
| 5G | RMB125.60 | In Stock |
|
| 25G | RMB352.00 | In Stock |
|
| 100g | RMB829.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 147-148℃ |
| Boiling point: | 321.2±42.0 °C(Predicted) |
| Density | 1.08±0.1 g/cm3(Predicted) |
| RTECS | GY5976010 |
| storage temp. | Amber Vial, -20°C Freezer, Under inert atmosphere |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 6.70±0.20(Predicted) |
| form | Solid |
| color | Off-white |
| Water Solubility | Slightly soluble in water. |
| Stability: | Light Sensitive |
| InChI | InChI=1S/C6H8N2/c7-4-5-2-1-3-6(5)8/h1-3,8H2 |
| InChIKey | NSMYBPIHVACKQG-UHFFFAOYSA-N |
| SMILES | C1(C#N)CCCC=1N |
| CAS DataBase Reference | 2941-23-3(CAS DataBase Reference) |
Description and Uses
2-Amino-1-cyclopentene-1-carbonitrile is a reagent used in the synthesis of tacrine-huperzine A hybrids as acetylcholinesterase inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H312-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| HS Code | 2926907090 |
