A1065512
5-Amino-1-methyl-1H-pyrazole-4-carbonitrile , 98% , 5334-41-8
CAS NO.：5334-41-8
Empirical Formula: C5H6N4
Molecular Weight: 122.13
MDL number: MFCD00114569
EINECS: 610-989-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB52.00 | In Stock |
|
| 1G | RMB79.20 | In Stock |
|
| 5G | RMB217.04 | In Stock |
|
| 25G | RMB819.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 221-223°C |
| Boiling point: | 342.4±27.0 °C(Predicted) |
| Density | 1.32±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | DMSO, Methanol |
| form | Solid |
| pka | 0.50±0.10(Predicted) |
| color | Off-White to Pale Beige |
| InChI | InChI=1S/C5H6N4/c1-9-5(7)4(2-6)3-8-9/h3H,7H2,1H3 |
| InChIKey | MZFBWODPTSTYAI-UHFFFAOYSA-N |
| SMILES | N1(C)C(N)=C(C#N)C=N1 |
| CAS DataBase Reference | 5334-41-8(CAS DataBase Reference) |
Description and Uses
An interesting synthetic intermediate
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271-P261-P280 |
| Hazard Codes | Xi |
| HazardClass | IRRITANT |
| HS Code | 2933199090 |
