A1078812
2-Amino-3,5-difluoropyridine , 98% , 732306-31-9
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB36.00 | In Stock |
|
| 1G | RMB80.80 | In Stock |
|
| 5G | RMB366.40 | In Stock |
|
| 25G | RMB1499.20 | In Stock |
|
| 100g | RMB6399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 55-57 |
| Boiling point: | 155.8±35.0 °C(Predicted) |
| Density | 1.393±0.06 g/cm3(Predicted) |
| Flash point: | 81℃ |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | solid |
| pka | 1.67±0.49(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C5H4F2N2/c6-3-1-4(7)5(8)9-2-3/h1-2H,(H2,8,9) |
| InChIKey | JVLFMTZUPSBCNJ-UHFFFAOYSA-N |
| SMILES | C1(N)=NC=C(F)C=C1F |
| CAS DataBase Reference | 732306-31-9(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| Hazard Note | Harmful/Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





