A1109212
Aluminum metaphosphate , AR , 13776-88-0
CAS NO.:13776-88-0
Empirical Formula: AlO9P3
Molecular Weight: 263.9
MDL number: MFCD00075314
EINECS: 237-415-3
| Pack Size | Price | Stock | Quantity |
| 100G | RMB64.00 | In Stock |
|
| 500G | RMB239.20 | In Stock |
|
| 2.5kg | RMB872.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 2.78 g/mL at 25 °C (lit.) |
| form | powder |
| Major Application | battery manufacturing |
| InChI | 1S/Al.3HO3P/c;3*1-4(2)3/h;3*(H,1,2,3)/q+3;;;/p-3 |
| InChIKey | DHAHRLDIUIPTCJ-UHFFFAOYSA-K |
| SMILES | O=P(=O)O[Al](OP(=O)=O)OP(=O)=O |
| EPA Substance Registry System | Metaphosphoric acid (HPO3), aluminum salt (13776-88-0) |
Description and Uses
As a constituent of glazes, enamels, and glasses, and as a high-temperature insulating cement.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 3 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |





